C25H21N3O5 — CID 18645536
[[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-(pyridine-3-carbonyl)amino] benzoate (PubChem CID 18645536) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is [[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-(pyridine-3-carbonyl)amino] benzoate.
| Compound Name | [[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-(pyridine-3-carbonyl)amino] benzoate |
|---|---|
| PubChem CID | 18645536 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-(pyridine-3-carbonyl)amino] benzoate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](N(OC(=O)c2ccccc2)C(=O)c2cccnc2)[C@H]1O |
| InChI | InChI=1S/C25H21N3O5/c1-25(2)22(29)21(19-13-16(14-26)10-11-20(19)32-25)28(23(30)18-9-6-12-27-15-18)33-24(31)17-7-4-3-5-8-17/h3-13,15,21-22,29H,1-2H3/t21-,22+/m0/s1 |
| InChIKey | SGJWOHXVVVDRIY-FCHUYYIVSA-N |
| XLogP | 3.44 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|