About [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate
[benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate (PubChem CID 54054743) has the molecular formula C26H20N2O5
and a molecular weight of 440.46 g/mol. Its IUPAC name is [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate.
Molecular Properties
| Compound Name | [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate |
| PubChem CID | 54054743 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(N(OC(=O)c2ccccc2)C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C26H20N2O5/c1-26(2)23(29)22(20-15-17(16-27)13-14-21(20)32-26)28(24(30)18-9-5-3-6-10-18)33-25(31)19-11-7-4-8-12-19/h3-15,22H,1-2H3 |
| InChIKey | LVLKVPYVODRRQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate?
The IUPAC name of [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate (CID 54054743) is [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate.
What is the SMILES notation for [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate?
The canonical SMILES for [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate is CC1(C)Oc2ccc(C#N)cc2C(N(OC(=O)c2ccccc2)C(=O)c2ccccc2)C1=O.
What is the InChIKey of [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate?
The InChIKey is LVLKVPYVODRRQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O5/c1-26(2)23(29)22(20-15-17(16-27)13-14-21(20)32-26)28(24(30)18-9-5-3-6-10-18)33-25(31)19-11-7-4-8-12-19/h3-15,22H,1-2H3.
What are the key properties of [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate?
[benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate has a molecular weight of 440.46 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [benzoyl-(6-cyano-2,2-dimethyl-3-oxo-4H-chromen-4-yl)amino] benzoate is sourced from PubChem (CID 54054743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).