C18H18N2O6S — CID 54425813
N-[(6R,7R)-2-acetyl-6-hydroxy-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-yl]-3-nitrobenzamide (PubChem CID 54425813) has the molecular formula C18H18N2O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is N-[(6R,7R)-2-acetyl-6-hydroxy-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-yl]-3-nitrobenzamide.
| Compound Name | N-[(6R,7R)-2-acetyl-6-hydroxy-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 54425813 |
| Molecular Formula | C18H18N2O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[(6R,7R)-2-acetyl-6-hydroxy-5,5-dimethyl-6,7-dihydrothieno[3,2-b]pyran-7-yl]-3-nitrobenzamide |
| SMILES | CC(=O)c1cc2c(s1)[C@H](NC(=O)c1cccc([N+](=O)[O-])c1)[C@@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C18H18N2O6S/c1-9(21)13-8-12-15(27-13)14(16(22)18(2,3)26-12)19-17(23)10-5-4-6-11(7-10)20(24)25/h4-8,14,16,22H,1-3H3,(H,19,23)/t14-,16+/m0/s1 |
| InChIKey | WDZKOOOGBNZSAF-GOEBONIOSA-N |
| XLogP | 2.86 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|