C16H22N2O4 — CID 97309175
N-[(1S,3R)-2,2-dimethyl-3-propan-2-yloxycyclobutyl]-3-nitrobenzamide (PubChem CID 97309175) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[(1S,3R)-2,2-dimethyl-3-propan-2-yloxycyclobutyl]-3-nitrobenzamide.
| Compound Name | N-[(1S,3R)-2,2-dimethyl-3-propan-2-yloxycyclobutyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 97309175 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[(1S,3R)-2,2-dimethyl-3-propan-2-yloxycyclobutyl]-3-nitrobenzamide |
| SMILES | CC(C)O[C@@H]1C[C@H](NC(=O)c2cccc([N+](=O)[O-])c2)C1(C)C |
| InChI | InChI=1S/C16H22N2O4/c1-10(2)22-14-9-13(16(14,3)4)17-15(19)11-6-5-7-12(8-11)18(20)21/h5-8,10,13-14H,9H2,1-4H3,(H,17,19)/t13-,14+/m0/s1 |
| InChIKey | KATSGQSXKOUDBX-UONOGXRCSA-N |
| XLogP | 2.92 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|