C16H21N3O2S — CID 15743537
1-[(3S,4R)-6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl]-3-propan-2-ylthiourea (PubChem CID 15743537) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-[(3S,4R)-6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl]-3-propan-2-ylthiourea.
| Compound Name | 1-[(3S,4R)-6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 15743537 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-[(3S,4R)-6-cyano-4-hydroxy-2,2-dimethyl-3,4-dihydrochromen-3-yl]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)N[C@H]1[C@H](O)c2cc(C#N)ccc2OC1(C)C |
| InChI | InChI=1S/C16H21N3O2S/c1-9(2)18-15(22)19-14-13(20)11-7-10(8-17)5-6-12(11)21-16(14,3)4/h5-7,9,13-14,20H,1-4H3,(H2,18,19,22)/t13-,14+/m1/s1 |
| InChIKey | IFMVUMNMUOWNLF-KGLIPLIRSA-N |
| XLogP | 2.00 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|