C19H18N2O2S — CID 15054565
(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-N-phenyl-3,4-dihydrochromene-4-carbothioamide (PubChem CID 15054565) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is (3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-N-phenyl-3,4-dihydrochromene-4-carbothioamide.
| Compound Name | (3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-N-phenyl-3,4-dihydrochromene-4-carbothioamide |
|---|---|
| PubChem CID | 15054565 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-N-phenyl-3,4-dihydrochromene-4-carbothioamide |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](C(=S)Nc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C19H18N2O2S/c1-19(2)17(22)16(18(24)21-13-6-4-3-5-7-13)14-10-12(11-20)8-9-15(14)23-19/h3-10,16-17,22H,1-2H3,(H,21,24)/t16-,17+/m1/s1 |
| InChIKey | MNKFPOGRFIZFMW-SJORKVTESA-N |
| XLogP | 3.61 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|