C20H19ClN5O2+ — CID 57234082
[amino-(4-chloroanilino)methylidene]-cyano-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]azanium (PubChem CID 57234082) has the molecular formula C20H19ClN5O2+ and a molecular weight of 396.86 g/mol. Its IUPAC name is [amino-(4-chloroanilino)methylidene]-cyano-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]azanium.
| Compound Name | [amino-(4-chloroanilino)methylidene]-cyano-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]azanium |
|---|---|
| PubChem CID | 57234082 |
| Molecular Formula | C20H19ClN5O2+ |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [amino-(4-chloroanilino)methylidene]-cyano-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]azanium |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](/[N+](C#N)=C(\N)Nc2ccc(Cl)cc2)[C@@H]1O |
| InChI | InChI=1S/C20H18ClN5O2/c1-20(2)18(27)17(15-9-12(10-22)3-8-16(15)28-20)26(11-23)19(24)25-14-6-4-13(21)5-7-14/h3-9,17-18,27H,1-2H3,(H2,24,25)/p+1/t17-,18+/m1/s1 |
| InChIKey | UBMROZLFZMHQTR-MSOLQXFVSA-O |
| XLogP | 2.71 |
| TPSA | 118.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|