C20H17ClFN5O2 — CID 10047383
1-(4-chloro-3-fluorophenyl)-3-cyano-2-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine (PubChem CID 10047383) has the molecular formula C20H17ClFN5O2 and a molecular weight of 413.84 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-cyano-2-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-cyano-2-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine |
|---|---|
| PubChem CID | 10047383 |
| Molecular Formula | C20H17ClFN5O2 |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-cyano-2-[(3S,4R)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]guanidine |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@@H](/N=C(\NC#N)Nc2ccc(Cl)c(F)c2)[C@@H]1O |
| InChI | InChI=1S/C20H17ClFN5O2/c1-20(2)18(28)17(13-7-11(9-23)3-6-16(13)29-20)27-19(25-10-24)26-12-4-5-14(21)15(22)8-12/h3-8,17-18,28H,1-2H3,(H2,25,26,27)/t17-,18+/m1/s1 |
| InChIKey | XYRPEQJKEVMQSV-MSOLQXFVSA-N |
| XLogP | 3.46 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|