C25H24ClN5O4S — CID 85261409
1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(phenylsulfamoyl)-3,4-dihydrochromen-4-yl]guanidine (PubChem CID 85261409) has the molecular formula C25H24ClN5O4S and a molecular weight of 526.02 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(phenylsulfamoyl)-3,4-dihydrochromen-4-yl]guanidine.
| Compound Name | 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(phenylsulfamoyl)-3,4-dihydrochromen-4-yl]guanidine |
|---|---|
| PubChem CID | 85261409 |
| Molecular Formula | C25H24ClN5O4S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(phenylsulfamoyl)-3,4-dihydrochromen-4-yl]guanidine |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)Nc3ccccc3)cc2C(/N=C(\NC#N)Nc2ccc(Cl)cc2)C1O |
| InChI | InChI=1S/C25H24ClN5O4S/c1-25(2)23(32)22(30-24(28-15-27)29-17-10-8-16(26)9-11-17)20-14-19(12-13-21(20)35-25)36(33,34)31-18-6-4-3-5-7-18/h3-14,22-23,31-32H,1-2H3,(H2,28,29,30) |
| InChIKey | QRZQNJQZKFPNHT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|