C25H30ClN5O4S — CID 85261465
1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(4-methylpiperidin-1-yl)sulfonyl-3,4-dihydrochromen-4-yl]guanidine (PubChem CID 85261465) has the molecular formula C25H30ClN5O4S and a molecular weight of 532.07 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(4-methylpiperidin-1-yl)sulfonyl-3,4-dihydrochromen-4-yl]guanidine.
| Compound Name | 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(4-methylpiperidin-1-yl)sulfonyl-3,4-dihydrochromen-4-yl]guanidine |
|---|---|
| PubChem CID | 85261465 |
| Molecular Formula | C25H30ClN5O4S |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-cyano-2-[3-hydroxy-2,2-dimethyl-6-(4-methylpiperidin-1-yl)sulfonyl-3,4-dihydrochromen-4-yl]guanidine |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)C(/N=C(\NC#N)Nc2ccc(Cl)cc2)C(O)C(C)(C)O3)CC1 |
| InChI | InChI=1S/C25H30ClN5O4S/c1-16-10-12-31(13-11-16)36(33,34)19-8-9-21-20(14-19)22(23(32)25(2,3)35-21)30-24(28-15-27)29-18-6-4-17(26)5-7-18/h4-9,14,16,22-23,32H,10-13H2,1-3H3,(H2,28,29,30) |
| InChIKey | PWSKFUFRRGNCKA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|