C18H20ClNO4S2 — CID 23820476
1-[3-(4-chlorophenyl)sulfonylphenyl]sulfonyl-4-methylpiperidine (PubChem CID 23820476) has the molecular formula C18H20ClNO4S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylphenyl]sulfonyl-4-methylpiperidine.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylphenyl]sulfonyl-4-methylpiperidine |
|---|---|
| PubChem CID | 23820476 |
| Molecular Formula | C18H20ClNO4S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylphenyl]sulfonyl-4-methylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)c2cccc(S(=O)(=O)c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C18H20ClNO4S2/c1-14-9-11-20(12-10-14)26(23,24)18-4-2-3-17(13-18)25(21,22)16-7-5-15(19)6-8-16/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | OJKDSKFTEVMHRN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |