C26H31ClN2O4S2 — CID 5026297
1-(1-adamantyl)-4-[3-(4-chlorophenyl)sulfonylphenyl]sulfonylpiperazine (PubChem CID 5026297) has the molecular formula C26H31ClN2O4S2 and a molecular weight of 535.13 g/mol. Its IUPAC name is 1-(1-adamantyl)-4-[3-(4-chlorophenyl)sulfonylphenyl]sulfonylpiperazine.
| Compound Name | 1-(1-adamantyl)-4-[3-(4-chlorophenyl)sulfonylphenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 5026297 |
| Molecular Formula | C26H31ClN2O4S2 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 1-(1-adamantyl)-4-[3-(4-chlorophenyl)sulfonylphenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1cccc(S(=O)(=O)N2CCN(C34CC5CC(CC(C5)C3)C4)CC2)c1 |
| InChI | InChI=1S/C26H31ClN2O4S2/c27-22-4-6-23(7-5-22)34(30,31)24-2-1-3-25(15-24)35(32,33)29-10-8-28(9-11-29)26-16-19-12-20(17-26)14-21(13-19)18-26/h1-7,15,19-21H,8-14,16-18H2 |
| InChIKey | KMWCGQOWRXLYAI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |