C23H31ClN2O4S — CID 24822202
2-(1-adamantyl)-N-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-hydroxyacetamide (PubChem CID 24822202) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-hydroxyacetamide.
| Compound Name | 2-(1-adamantyl)-N-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 24822202 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-(1-adamantyl)-N-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-hydroxyacetamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1)C(O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31ClN2O4S/c24-18-1-3-20(4-2-18)31(29,30)26-7-5-19(6-8-26)25-22(28)21(27)23-12-15-9-16(13-23)11-17(10-15)14-23/h1-4,15-17,19,21,27H,5-14H2,(H,25,28) |
| InChIKey | FXCANWQFKZQQQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |