C20H26Cl2N2O2S — CID 4264866
1-(1-adamantyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine (PubChem CID 4264866) has the molecular formula C20H26Cl2N2O2S and a molecular weight of 429.41 g/mol. Its IUPAC name is 1-(1-adamantyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine.
| Compound Name | 1-(1-adamantyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 4264866 |
| Molecular Formula | C20H26Cl2N2O2S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 1-(1-adamantyl)-4-(3,4-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCN(C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C20H26Cl2N2O2S/c21-18-2-1-17(10-19(18)22)27(25,26)24-5-3-23(4-6-24)20-11-14-7-15(12-20)9-16(8-14)13-20/h1-2,10,14-16H,3-9,11-13H2 |
| InChIKey | HUQNMPBMMHHCIB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |