C26H30N2O6S2 — CID 25123757
2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]anthracene-9,10-dione (PubChem CID 25123757) has the molecular formula C26H30N2O6S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]anthracene-9,10-dione.
| Compound Name | 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 25123757 |
| Molecular Formula | C26H30N2O6S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 2,7-bis[(4-methylpiperidin-1-yl)sulfonyl]anthracene-9,10-dione |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)N4CCC(C)CC4)ccc2C3=O)CC1 |
| InChI | InChI=1S/C26H30N2O6S2/c1-17-7-11-27(12-8-17)35(31,32)19-3-5-21-23(15-19)26(30)24-16-20(4-6-22(24)25(21)29)36(33,34)28-13-9-18(2)10-14-28/h3-6,15-18H,7-14H2,1-2H3 |
| InChIKey | BYFUVUKVEBTNEJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|