C28H34ClN5O4S — CID 10698312
2-[(3S,4R)-6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-(4-chlorophenyl)-3-cyanoguanidine (PubChem CID 10698312) has the molecular formula C28H34ClN5O4S and a molecular weight of 572.13 g/mol. Its IUPAC name is 2-[(3S,4R)-6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-(4-chlorophenyl)-3-cyanoguanidine.
| Compound Name | 2-[(3S,4R)-6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-(4-chlorophenyl)-3-cyanoguanidine |
|---|---|
| PubChem CID | 10698312 |
| Molecular Formula | C28H34ClN5O4S |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 2-[(3S,4R)-6-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylsulfonyl)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-1-(4-chlorophenyl)-3-cyanoguanidine |
| SMILES | CC1(C)Oc2ccc(S(=O)(=O)N3CCCC4CCCCC43)cc2[C@@H](/N=C(\NC#N)Nc2ccc(Cl)cc2)[C@@H]1O |
| InChI | InChI=1S/C28H34ClN5O4S/c1-28(2)26(35)25(33-27(31-17-30)32-20-11-9-19(29)10-12-20)22-16-21(13-14-24(22)38-28)39(36,37)34-15-5-7-18-6-3-4-8-23(18)34/h9-14,16,18,23,25-26,35H,3-8,15H2,1-2H3,(H2,31,32,33)/t18?,23?,25-,26+/m1/s1 |
| InChIKey | KDYMNODHGGHMKO-HEOMDQNJSA-N |
| XLogP | 4.80 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|