C14H17FN2O3S — CID 126826986
N-[5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2-fluorophenyl]acetamide (PubChem CID 126826986) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2-fluorophenyl]acetamide.
| Compound Name | N-[5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 126826986 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[5-(2-azabicyclo[4.1.0]heptan-2-ylsulfonyl)-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)N2CCCC3CC32)ccc1F |
| InChI | InChI=1S/C14H17FN2O3S/c1-9(18)16-13-8-11(4-5-12(13)15)21(19,20)17-6-2-3-10-7-14(10)17/h4-5,8,10,14H,2-3,6-7H2,1H3,(H,16,18) |
| InChIKey | MCTLQGOKXLTPLZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |