C12H13FN2O3S — CID 126840764
N-[5-(2,5-dihydropyrrol-1-ylsulfonyl)-2-fluorophenyl]acetamide (PubChem CID 126840764) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is N-[5-(2,5-dihydropyrrol-1-ylsulfonyl)-2-fluorophenyl]acetamide.
| Compound Name | N-[5-(2,5-dihydropyrrol-1-ylsulfonyl)-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 126840764 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[5-(2,5-dihydropyrrol-1-ylsulfonyl)-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)N2CC=CC2)ccc1F |
| InChI | InChI=1S/C12H13FN2O3S/c1-9(16)14-12-8-10(4-5-11(12)13)19(17,18)15-6-2-3-7-15/h2-5,8H,6-7H2,1H3,(H,14,16) |
| InChIKey | DZMRDFYLERHDHQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|