C12H16FN3O3S — CID 119967297
N-[2-fluoro-5-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 119967297) has the molecular formula C12H16FN3O3S and a molecular weight of 301.34 g/mol. Its IUPAC name is N-[2-fluoro-5-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[2-fluoro-5-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 119967297 |
| Molecular Formula | C12H16FN3O3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[2-fluoro-5-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)NC2CCNC2)ccc1F |
| InChI | InChI=1S/C12H16FN3O3S/c1-8(17)15-12-6-10(2-3-11(12)13)20(18,19)16-9-4-5-14-7-9/h2-3,6,9,14,16H,4-5,7H2,1H3,(H,15,17) |
| InChIKey | CUKHWKVAPFGEFM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |