C12H16BrN3O3S — CID 120707655
N-[2-bromo-4-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide (PubChem CID 120707655) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is N-[2-bromo-4-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[2-bromo-4-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 120707655 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N-[2-bromo-4-(pyrrolidin-3-ylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCNC2)cc1Br |
| InChI | InChI=1S/C12H16BrN3O3S/c1-8(17)15-12-3-2-10(6-11(12)13)20(18,19)16-9-4-5-14-7-9/h2-3,6,9,14,16H,4-5,7H2,1H3,(H,15,17) |
| InChIKey | HTTGQNUOCXDMNT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |