C14H20BrN3O3S — CID 120723238
N-[2-bromo-4-[(4-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide (PubChem CID 120723238) has the molecular formula C14H20BrN3O3S and a molecular weight of 390.30 g/mol. Its IUPAC name is N-[2-bromo-4-[(4-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[2-bromo-4-[(4-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 120723238 |
| Molecular Formula | C14H20BrN3O3S |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | N-[2-bromo-4-[(4-methylpiperidin-3-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CNCCC2C)cc1Br |
| InChI | InChI=1S/C14H20BrN3O3S/c1-9-5-6-16-8-14(9)18-22(20,21)11-3-4-13(12(15)7-11)17-10(2)19/h3-4,7,9,14,16,18H,5-6,8H2,1-2H3,(H,17,19) |
| InChIKey | VLJHKFCVPOKTQP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |