C14H18BrN3O3S — CID 120714086
N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-bromophenyl]acetamide (PubChem CID 120714086) has the molecular formula C14H18BrN3O3S and a molecular weight of 388.29 g/mol. Its IUPAC name is N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-bromophenyl]acetamide.
| Compound Name | N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-bromophenyl]acetamide |
|---|---|
| PubChem CID | 120714086 |
| Molecular Formula | C14H18BrN3O3S |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | N-[4-[[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]-2-bromophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2C[C@H]3CNC[C@H]3C2)cc1Br |
| InChI | InChI=1S/C14H18BrN3O3S/c1-9(19)17-14-3-2-12(4-13(14)15)22(20,21)18-7-10-5-16-6-11(10)8-18/h2-4,10-11,16H,5-8H2,1H3,(H,17,19)/t10-,11+ |
| InChIKey | PEMYWHCSWVWCCX-PHIMTYICSA-N |
| XLogP | 1.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |