About N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide
N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide (PubChem CID 119991889) has the molecular formula C14H22FN3O3S
and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide.
Molecular Properties
| Compound Name | N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide |
| PubChem CID | 119991889 |
| Molecular Formula | C14H22FN3O3S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)N(C)CC(C)(C)CN)ccc1F |
| InChI | InChI=1S/C14H22FN3O3S/c1-10(19)17-13-7-11(5-6-12(13)15)22(20,21)18(4)9-14(2,3)8-16/h5-7H,8-9,16H2,1-4H3,(H,17,19) |
| InChIKey | XPWKKAAYWZYBTJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide?
The IUPAC name of N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide (CID 119991889) is N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide.
What is the SMILES notation for N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide?
The canonical SMILES for N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide is CC(=O)Nc1cc(S(=O)(=O)N(C)CC(C)(C)CN)ccc1F.
What is the InChIKey of N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide?
The InChIKey is XPWKKAAYWZYBTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FN3O3S/c1-10(19)17-13-7-11(5-6-12(13)15)22(20,21)18(4)9-14(2,3)8-16/h5-7H,8-9,16H2,1-4H3,(H,17,19).
What are the key properties of N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide?
N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide has a molecular weight of 331.41 g/mol, XLogP of 1.39, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3-amino-2,2-dimethylpropyl)-methylsulfamoyl]-2-fluorophenyl]acetamide is sourced from PubChem (CID 119991889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).