C15H24FN3O3S — CID 119992394
N-[5-[(3-amino-4-methylpentyl)-methylsulfamoyl]-2-fluorophenyl]acetamide (PubChem CID 119992394) has the molecular formula C15H24FN3O3S and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[5-[(3-amino-4-methylpentyl)-methylsulfamoyl]-2-fluorophenyl]acetamide.
| Compound Name | N-[5-[(3-amino-4-methylpentyl)-methylsulfamoyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 119992394 |
| Molecular Formula | C15H24FN3O3S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[5-[(3-amino-4-methylpentyl)-methylsulfamoyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(S(=O)(=O)N(C)CCC(N)C(C)C)ccc1F |
| InChI | InChI=1S/C15H24FN3O3S/c1-10(2)14(17)7-8-19(4)23(21,22)12-5-6-13(16)15(9-12)18-11(3)20/h5-6,9-10,14H,7-8,17H2,1-4H3,(H,18,20) |
| InChIKey | HEKDPZIPHXWPHY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |