C18H31N3O3S — CID 119992307
4-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N,N-diethylbenzamide (PubChem CID 119992307) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is 4-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N,N-diethylbenzamide.
| Compound Name | 4-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 119992307 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 4-[(3-amino-4-methylpentyl)-methylsulfamoyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)N(C)CCC(N)C(C)C)cc1 |
| InChI | InChI=1S/C18H31N3O3S/c1-6-21(7-2)18(22)15-8-10-16(11-9-15)25(23,24)20(5)13-12-17(19)14(3)4/h8-11,14,17H,6-7,12-13,19H2,1-5H3 |
| InChIKey | GBXXZFHETBTCQS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |