C14H23FN2O2S — CID 119992136
N-(3-amino-4-methylpentyl)-4-fluoro-N,3-dimethylbenzenesulfonamide (PubChem CID 119992136) has the molecular formula C14H23FN2O2S and a molecular weight of 302.42 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-fluoro-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-(3-amino-4-methylpentyl)-4-fluoro-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 119992136 |
| Molecular Formula | C14H23FN2O2S |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-fluoro-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CCC(N)C(C)C)ccc1F |
| InChI | InChI=1S/C14H23FN2O2S/c1-10(2)14(16)7-8-17(4)20(18,19)12-5-6-13(15)11(3)9-12/h5-6,9-10,14H,7-8,16H2,1-4H3 |
| InChIKey | OGCUEIOAJJCRME-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |