C18H30N4O4S — CID 119660507
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-(3-amino-4-methylpentyl)-N-methylacetamide (PubChem CID 119660507) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-(3-amino-4-methylpentyl)-N-methylacetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-(3-amino-4-methylpentyl)-N-methylacetamide |
|---|---|
| PubChem CID | 119660507 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-(3-amino-4-methylpentyl)-N-methylacetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)N(C)CCC(N)C(C)C)cc1 |
| InChI | InChI=1S/C18H30N4O4S/c1-13(2)17(19)10-11-21(4)18(24)12-22(5)27(25,26)16-8-6-15(7-9-16)20-14(3)23/h6-9,13,17H,10-12,19H2,1-5H3,(H,20,23) |
| InChIKey | RLRJZBIKBRPYDF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |