C14H22N4O4S — CID 120505509
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(2S)-1-aminopropan-2-yl]acetamide (PubChem CID 120505509) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(2S)-1-aminopropan-2-yl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(2S)-1-aminopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 120505509 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(2S)-1-aminopropan-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(C)CC(=O)N[C@@H](C)CN)cc1 |
| InChI | InChI=1S/C14H22N4O4S/c1-10(8-15)16-14(20)9-18(3)23(21,22)13-6-4-12(5-7-13)17-11(2)19/h4-7,10H,8-9,15H2,1-3H3,(H,16,20)(H,17,19)/t10-/m0/s1 |
| InChIKey | UKQDDFJSIGPBFN-JTQLQIEISA-N |
| XLogP | -0.27 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |