C36H24Cl2N6O8S2 — CID 87938010
5-[[7-[[N'-[7-[(3-carboxy-4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]-2-chlorobenzoic acid (PubChem CID 87938010) has the molecular formula C36H24Cl2N6O8S2 and a molecular weight of 803.66 g/mol. Its IUPAC name is 5-[[7-[[N'-[7-[(3-carboxy-4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]-2-chlorobenzoic acid.
| Compound Name | 5-[[7-[[N'-[7-[(3-carboxy-4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 87938010 |
| Molecular Formula | C36H24Cl2N6O8S2 |
| Molecular Weight | 803.66 g/mol |
| Exact Mass | 802.05 |
| IUPAC Name | 5-[[7-[[N'-[7-[(3-carboxy-4-chlorophenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]-2-chlorobenzoic acid |
| SMILES | N#CN/C(=N\c1ccc2ccc(NS(=O)(=O)c3ccc(Cl)c(C(=O)O)c3)cc2c1)Nc1ccc2ccc(NS(=O)(=O)c3ccc(Cl)c(C(=O)O)c3)cc2c1 |
| InChI | InChI=1S/C36H24Cl2N6O8S2/c37-32-11-9-28(17-30(32)34(45)46)53(49,50)43-26-7-3-20-1-5-24(13-22(20)15-26)41-36(40-19-39)42-25-6-2-21-4-8-27(16-23(21)14-25)44-54(51,52)29-10-12-33(38)31(18-29)35(47)48/h1-18,43-44H,(H,45,46)(H,47,48)(H2,40,41,42) |
| InChIKey | BDCLXYRSZYPUAX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 227.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|