C38H28Cl2N6O8S2 — CID 87937985
methyl 2-chloro-5-[[7-[[N'-[7-[(4-chloro-3-methoxycarbonylphenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]benzoate (PubChem CID 87937985) has the molecular formula C38H28Cl2N6O8S2 and a molecular weight of 831.72 g/mol. Its IUPAC name is methyl 2-chloro-5-[[7-[[N'-[7-[(4-chloro-3-methoxycarbonylphenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]benzoate.
| Compound Name | methyl 2-chloro-5-[[7-[[N'-[7-[(4-chloro-3-methoxycarbonylphenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 87937985 |
| Molecular Formula | C38H28Cl2N6O8S2 |
| Molecular Weight | 831.72 g/mol |
| Exact Mass | 830.08 |
| IUPAC Name | methyl 2-chloro-5-[[7-[[N'-[7-[(4-chloro-3-methoxycarbonylphenyl)sulfonylamino]naphthalen-2-yl]-N-cyanocarbamimidoyl]amino]naphthalen-2-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)Nc2ccc3ccc(/N=C(\NC#N)Nc4ccc5ccc(NS(=O)(=O)c6ccc(Cl)c(C(=O)OC)c6)cc5c4)cc3c2)ccc1Cl |
| InChI | InChI=1S/C38H28Cl2N6O8S2/c1-53-36(47)32-19-30(11-13-34(32)39)55(49,50)45-28-9-5-22-3-7-26(15-24(22)17-28)43-38(42-21-41)44-27-8-4-23-6-10-29(18-25(23)16-27)46-56(51,52)31-12-14-35(40)33(20-31)37(48)54-2/h3-20,45-46H,1-2H3,(H2,42,43,44) |
| InChIKey | LQBUTXPQHCKANT-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.72 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|