C27H25N5O3 — CID 23184311
1-cyano-2-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-phenylmethoxyphenyl)guanidine (PubChem CID 23184311) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-cyano-2-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-phenylmethoxyphenyl)guanidine.
| Compound Name | 1-cyano-2-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-phenylmethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 23184311 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 1-cyano-2-(6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-phenylmethoxyphenyl)guanidine |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(/N=C(\NC#N)Nc2ccc(OCc3ccccc3)cc2)C1O |
| InChI | InChI=1S/C27H25N5O3/c1-27(2)25(33)24(22-14-19(15-28)8-13-23(22)35-27)32-26(30-17-29)31-20-9-11-21(12-10-20)34-16-18-6-4-3-5-7-18/h3-14,24-25,33H,16H2,1-2H3,(H2,30,31,32) |
| InChIKey | WUFYBMWGXAFMLY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|