C18H23N5O5 — CID 54069392
[(3R,4S)-4-[acetyl-(methylcarbamoylamino)amino]-6-cyano-2,2-dimethyl-3,4-dihydrochromen-3-yl] N-methylcarbamate (PubChem CID 54069392) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is [(3R,4S)-4-[acetyl-(methylcarbamoylamino)amino]-6-cyano-2,2-dimethyl-3,4-dihydrochromen-3-yl] N-methylcarbamate.
| Compound Name | [(3R,4S)-4-[acetyl-(methylcarbamoylamino)amino]-6-cyano-2,2-dimethyl-3,4-dihydrochromen-3-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 54069392 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(3R,4S)-4-[acetyl-(methylcarbamoylamino)amino]-6-cyano-2,2-dimethyl-3,4-dihydrochromen-3-yl] N-methylcarbamate |
| SMILES | CNC(=O)NN(C(C)=O)[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1OC(=O)NC |
| InChI | InChI=1S/C18H23N5O5/c1-10(24)23(22-16(25)20-4)14-12-8-11(9-19)6-7-13(12)28-18(2,3)15(14)27-17(26)21-5/h6-8,14-15H,1-5H3,(H,21,26)(H2,20,22,25)/t14-,15+/m0/s1 |
| InChIKey | MFHQXTMXCBQBOX-LSDHHAIUSA-N |
| XLogP | 1.19 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|