C14H14N2O5 — CID 7303177
(1S,9R)-12-acetyl-9-methyl-4-nitro-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 7303177) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (1S,9R)-12-acetyl-9-methyl-4-nitro-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1S,9R)-12-acetyl-9-methyl-4-nitro-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 7303177 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S,9R)-12-acetyl-9-methyl-4-nitro-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | CC(=O)C1C(=O)N[C@@]2(C)C[C@@H]1c1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C14H14N2O5/c1-7(17)12-10-6-14(2,15-13(12)18)21-11-4-3-8(16(19)20)5-9(10)11/h3-5,10,12H,6H2,1-2H3,(H,15,18)/t10-,12?,14-/m1/s1 |
| InChIKey | VMAPULLZNHEYCO-GYYYEOQOSA-N |
| XLogP | 1.51 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|