C20H20BrNO4S — CID 98148957
(1R,9S,12S)-4-bromo-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 98148957) has the molecular formula C20H20BrNO4S and a molecular weight of 450.35 g/mol. Its IUPAC name is (1R,9S,12S)-4-bromo-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | (1R,9S,12S)-4-bromo-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 98148957 |
| Molecular Formula | C20H20BrNO4S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | (1R,9S,12S)-4-bromo-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C(=O)N[C@]3(C)C[C@@H]2c2cc(Br)ccc2O3)cc1C |
| InChI | InChI=1S/C20H20BrNO4S/c1-11-4-6-14(8-12(11)2)27(24,25)18-16-10-20(3,22-19(18)23)26-17-7-5-13(21)9-15(16)17/h4-9,16,18H,10H2,1-3H3,(H,22,23)/t16-,18+,20+/m1/s1 |
| InChIKey | ULYLPVSVZUYLKA-KPFFTGBYSA-N |
| XLogP | 3.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |