C20H21NO4S — CID 7184696
(1S,9S,12S)-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one (PubChem CID 7184696) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is (1S,9S,12S)-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one.
| Compound Name | (1S,9S,12S)-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 7184696 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (1S,9S,12S)-12-(3,4-dimethylphenyl)sulfonyl-9-methyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-11-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C(=O)N[C@]3(C)C[C@H]2c2ccccc2O3)cc1C |
| InChI | InChI=1S/C20H21NO4S/c1-12-8-9-14(10-13(12)2)26(23,24)18-16-11-20(3,21-19(18)22)25-17-7-5-4-6-15(16)17/h4-10,16,18H,11H2,1-3H3,(H,21,22)/t16-,18-,20-/m0/s1 |
| InChIKey | SDWYCGHVGZLGBK-QRFRQXIXSA-N |
| XLogP | 2.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |