About (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate
(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate (PubChem CID 174747498) has the molecular formula C13H15FO3
and a molecular weight of 238.26 g/mol. Its IUPAC name is (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate.
Molecular Properties
| Compound Name | (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate |
| PubChem CID | 174747498 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(C)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FO3/c1-8(15)16-12-7-13(2,3)17-11-5-4-9(14)6-10(11)12/h4-6,12H,7H2,1-3H3 |
| InChIKey | GNYANLKFUIEDKJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate?
The IUPAC name of (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate (CID 174747498) is (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate.
What is the SMILES notation for (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate?
The canonical SMILES for (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate is CC(=O)OC1CC(C)(C)Oc2ccc(F)cc21.
What is the InChIKey of (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate?
The InChIKey is GNYANLKFUIEDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO3/c1-8(15)16-12-7-13(2,3)17-11-5-4-9(14)6-10(11)12/h4-6,12H,7H2,1-3H3.
What are the key properties of (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate?
(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate has a molecular weight of 238.26 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate is sourced from PubChem (CID 174747498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).