C13H15FO3 — CID 174747498
(6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate (PubChem CID 174747498) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate.
| Compound Name | (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate |
|---|---|
| PubChem CID | 174747498 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(C)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FO3/c1-8(15)16-12-7-13(2,3)17-11-5-4-9(14)6-10(11)12/h4-6,12H,7H2,1-3H3 |
| InChIKey | GNYANLKFUIEDKJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |