C12H15FO2 — CID 114714151
2-ethyl-6-fluoro-2-methyl-3,4-dihydrochromen-4-ol (PubChem CID 114714151) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-ethyl-6-fluoro-2-methyl-3,4-dihydrochromen-4-ol.
| Compound Name | 2-ethyl-6-fluoro-2-methyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114714151 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-ethyl-6-fluoro-2-methyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(C)CC(O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C12H15FO2/c1-3-12(2)7-10(14)9-6-8(13)4-5-11(9)15-12/h4-6,10,14H,3,7H2,1-2H3 |
| InChIKey | UEZIAOZPCXBJPJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |