C12H15BrO2 — CID 104949705
(4S)-7-bromo-2-ethyl-2-methyl-3,4-dihydrochromen-4-ol (PubChem CID 104949705) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (4S)-7-bromo-2-ethyl-2-methyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-7-bromo-2-ethyl-2-methyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104949705 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (4S)-7-bromo-2-ethyl-2-methyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(C)C[C@H](O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C12H15BrO2/c1-3-12(2)7-10(14)9-5-4-8(13)6-11(9)15-12/h4-6,10,14H,3,7H2,1-2H3/t10-,12?/m0/s1 |
| InChIKey | GBTBKUKQJDUGSY-NUHJPDEHSA-N |
| XLogP | 3.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |