C13H17BrO3 — CID 114714714
7-bromo-2-ethyl-2-(methoxymethyl)-3,4-dihydrochromen-4-ol (PubChem CID 114714714) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is 7-bromo-2-ethyl-2-(methoxymethyl)-3,4-dihydrochromen-4-ol.
| Compound Name | 7-bromo-2-ethyl-2-(methoxymethyl)-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114714714 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 7-bromo-2-ethyl-2-(methoxymethyl)-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(COC)CC(O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C13H17BrO3/c1-3-13(8-16-2)7-11(15)10-5-4-9(14)6-12(10)17-13/h4-6,11,15H,3,7-8H2,1-2H3 |
| InChIKey | QCIJFZGJEGKAGU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |