About (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol
(4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol (PubChem CID 104951740) has the molecular formula C16H23FO2
and a molecular weight of 266.36 g/mol. Its IUPAC name is (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol |
| PubChem CID | 104951740 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol |
| SMILES | CCC(C)CC1(CC)C[C@@H](O)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C16H23FO2/c1-4-11(3)9-16(5-2)10-14(18)13-7-6-12(17)8-15(13)19-16/h6-8,11,14,18H,4-5,9-10H2,1-3H3/t11?,14-,16?/m1/s1 |
| InChIKey | VNYIXNICHQWBAN-OFWKBQFLSA-N |
| XLogP | 4.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol?
The IUPAC name of (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol (CID 104951740) is (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol.
What is the SMILES notation for (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol?
The canonical SMILES for (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol is CCC(C)CC1(CC)C[C@@H](O)c2ccc(F)cc2O1.
What is the InChIKey of (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol?
The InChIKey is VNYIXNICHQWBAN-OFWKBQFLSA-N. The full InChI is InChI=1S/C16H23FO2/c1-4-11(3)9-16(5-2)10-14(18)13-7-6-12(17)8-15(13)19-16/h6-8,11,14,18H,4-5,9-10H2,1-3H3/t11?,14-,16?/m1/s1.
What are the key properties of (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol?
(4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol has a molecular weight of 266.36 g/mol, XLogP of 4.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-ethyl-7-fluoro-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 104951740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).