C17H26O2 — CID 104950454
(4R)-2-ethyl-6-methyl-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol (PubChem CID 104950454) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (4R)-2-ethyl-6-methyl-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol.
| Compound Name | (4R)-2-ethyl-6-methyl-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104950454 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (4R)-2-ethyl-6-methyl-2-(2-methylbutyl)-3,4-dihydrochromen-4-ol |
| SMILES | CCC(C)CC1(CC)C[C@@H](O)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C17H26O2/c1-5-12(3)10-17(6-2)11-15(18)14-9-13(4)7-8-16(14)19-17/h7-9,12,15,18H,5-6,10-11H2,1-4H3/t12?,15-,17?/m1/s1 |
| InChIKey | FMZJVIKMFIHQSG-YAJUMTOWSA-N |
| XLogP | 4.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |