C13H18O2 — CID 104950045
(4R)-2,2-diethyl-3,4-dihydrochromen-4-ol (PubChem CID 104950045) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (4R)-2,2-diethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4R)-2,2-diethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104950045 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4R)-2,2-diethyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(CC)C[C@@H](O)c2ccccc2O1 |
| InChI | InChI=1S/C13H18O2/c1-3-13(4-2)9-11(14)10-7-5-6-8-12(10)15-13/h5-8,11,14H,3-4,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | JYFPPXNHKJDIKX-LLVKDONJSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |