C13H18O3 — CID 114714861
2-(1-methoxyethyl)-2-methyl-3,4-dihydrochromen-4-ol (PubChem CID 114714861) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-(1-methoxyethyl)-2-methyl-3,4-dihydrochromen-4-ol.
| Compound Name | 2-(1-methoxyethyl)-2-methyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114714861 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-(1-methoxyethyl)-2-methyl-3,4-dihydrochromen-4-ol |
| SMILES | COC(C)C1(C)CC(O)c2ccccc2O1 |
| InChI | InChI=1S/C13H18O3/c1-9(15-3)13(2)8-11(14)10-6-4-5-7-12(10)16-13/h4-7,9,11,14H,8H2,1-3H3 |
| InChIKey | HZUJXQKHZVCSPW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |