About 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol
2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol (PubChem CID 114714855) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 114714855 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(C2CC2)CC(O)c2ccccc2O1 |
| InChI | InChI=1S/C14H18O2/c1-2-14(10-7-8-10)9-12(15)11-5-3-4-6-13(11)16-14/h3-6,10,12,15H,2,7-9H2,1H3 |
| InChIKey | CBUKYFSAVMLISK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol (CID 114714855) is 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol is CCC1(C2CC2)CC(O)c2ccccc2O1.
What is the InChIKey of 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol?
The InChIKey is CBUKYFSAVMLISK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-2-14(10-7-8-10)9-12(15)11-5-3-4-6-13(11)16-14/h3-6,10,12,15H,2,7-9H2,1H3.
What are the key properties of 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol?
2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol has a molecular weight of 218.30 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-ethyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 114714855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).