C15H19FO2 — CID 114276167
(4S)-2-cyclopropyl-6-fluoro-2-propyl-3,4-dihydrochromen-4-ol (PubChem CID 114276167) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (4S)-2-cyclopropyl-6-fluoro-2-propyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-2-cyclopropyl-6-fluoro-2-propyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 114276167 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (4S)-2-cyclopropyl-6-fluoro-2-propyl-3,4-dihydrochromen-4-ol |
| SMILES | CCCC1(C2CC2)C[C@H](O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H19FO2/c1-2-7-15(10-3-4-10)9-13(17)12-8-11(16)5-6-14(12)18-15/h5-6,8,10,13,17H,2-4,7,9H2,1H3/t13-,15?/m0/s1 |
| InChIKey | YZMRKXDDHFAYHD-CFMCSPIPSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |