C11H13FO2 — CID 10888842
(4R)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 10888842) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is (4R)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4R)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 10888842 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (4R)-6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)C[C@@H](O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H13FO2/c1-11(2)6-9(13)8-5-7(12)3-4-10(8)14-11/h3-5,9,13H,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | BEZSNFOXBWMXRK-SECBINFHSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |