C12H13FO3 — CID 114714192
6-fluorospiro[3,4-dihydrochromene-2,3'-oxolane]-4-ol (PubChem CID 114714192) has the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. Its IUPAC name is 6-fluorospiro[3,4-dihydrochromene-2,3'-oxolane]-4-ol.
| Compound Name | 6-fluorospiro[3,4-dihydrochromene-2,3'-oxolane]-4-ol |
|---|---|
| PubChem CID | 114714192 |
| Molecular Formula | C12H13FO3 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-fluorospiro[3,4-dihydrochromene-2,3'-oxolane]-4-ol |
| SMILES | OC1CC2(CCOC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C12H13FO3/c13-8-1-2-11-9(5-8)10(14)6-12(16-11)3-4-15-7-12/h1-2,5,10,14H,3-4,6-7H2 |
| InChIKey | AJNJIGBCWNCUDB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |