About 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol
7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol (PubChem CID 112549056) has the molecular formula C13H15FO3
and a molecular weight of 238.26 g/mol. Its IUPAC name is 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol.
Molecular Properties
| Compound Name | 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
| PubChem CID | 112549056 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
| SMILES | OC1CC2(CCOCC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FO3/c14-9-1-2-10-11(15)8-13(17-12(10)7-9)3-5-16-6-4-13/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | JGVYGHAHTQJERB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol?
The IUPAC name of 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol (CID 112549056) is 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol.
What is the SMILES notation for 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol?
The canonical SMILES for 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol is OC1CC2(CCOCC2)Oc2cc(F)ccc21.
What is the InChIKey of 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol?
The InChIKey is JGVYGHAHTQJERB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO3/c14-9-1-2-10-11(15)8-13(17-12(10)7-9)3-5-16-6-4-13/h1-2,7,11,15H,3-6,8H2.
What are the key properties of 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol?
7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol has a molecular weight of 238.26 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol is sourced from PubChem (CID 112549056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).