C13H15FO3 — CID 112549056
7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol (PubChem CID 112549056) has the molecular formula C13H15FO3 and a molecular weight of 238.26 g/mol. Its IUPAC name is 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol.
| Compound Name | 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
|---|---|
| PubChem CID | 112549056 |
| Molecular Formula | C13H15FO3 |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 7-fluorospiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
| SMILES | OC1CC2(CCOCC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H15FO3/c14-9-1-2-10-11(15)8-13(17-12(10)7-9)3-5-16-6-4-13/h1-2,7,11,15H,3-6,8H2 |
| InChIKey | JGVYGHAHTQJERB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |