About 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol
4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 114715684) has the molecular formula C16H21FO2
and a molecular weight of 264.34 g/mol. Its IUPAC name is 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
Molecular Properties
| Compound Name | 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| PubChem CID | 114715684 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | CCC1CCC2(CC1)CC(O)c1ccc(F)cc1O2 |
| InChI | InChI=1S/C16H21FO2/c1-2-11-5-7-16(8-6-11)10-14(18)13-4-3-12(17)9-15(13)19-16/h3-4,9,11,14,18H,2,5-8,10H2,1H3 |
| InChIKey | BWUFCPGLCYJOKC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The IUPAC name of 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (CID 114715684) is 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
What is the SMILES notation for 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The canonical SMILES for 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol is CCC1CCC2(CC1)CC(O)c1ccc(F)cc1O2.
What is the InChIKey of 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
The InChIKey is BWUFCPGLCYJOKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21FO2/c1-2-11-5-7-16(8-6-11)10-14(18)13-4-3-12(17)9-15(13)19-16/h3-4,9,11,14,18H,2,5-8,10H2,1H3.
What are the key properties of 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol?
4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol has a molecular weight of 264.34 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-ethyl-7-fluorospiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol is sourced from PubChem (CID 114715684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).