C13H16FNO2 — CID 104951801
(4S)-7-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol (PubChem CID 104951801) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (4S)-7-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol.
| Compound Name | (4S)-7-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 104951801 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (4S)-7-fluorospiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
| SMILES | O[C@H]1CC2(CCNCC2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H16FNO2/c14-9-1-2-10-11(16)8-13(17-12(10)7-9)3-5-15-6-4-13/h1-2,7,11,15-16H,3-6,8H2/t11-/m0/s1 |
| InChIKey | VPSHIJOKPJKPMX-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |